| Name |
Isoimperatorin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
482-45-1 |
| C_ID |
C00030532
, 
|
| InChIKey |
IGWDEVSBEKYORK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 |
| SMILES |
CC(C)=CCOc1c2ccoc2cc2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Angelica taiwaniana | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Ferulago capillaris | Ref. |
| Plantae | Apiaceae | Ferulago turcomanica | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Peucedanum baicalense | Ref. |
| Plantae | Apiaceae | Peucedanum dhana | Ref. |
| Plantae | Apiaceae | Phlojodicarpus sibiricus | Ref. |
| Plantae | Apiaceae | Pleurospermum angelicoides | Ref. |
| Plantae | Apiaceae | Prangos bucharica | Ref. |
| Plantae | Apiaceae | Prangos latiloba | Ref. |
| Plantae | Apiaceae | Prangos pabularia  | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata Schischkin | Ref. |
| Plantae | Apiaceae | Seseli eriocephalum | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Moraceae | Dorstenia gigas | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| - | - | Komarovia anisospermum | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|