| Name |
Lauric acid Docosanoic acid n-Dodecanoic acid Dodecanoic acid |
| Formula |
C12H24O2 |
| Mw |
200.17763001 |
| CAS RN |
143-07-7 |
| C_ID |
C00001221
, 
|
| InChIKey |
POULHZVOKOAJMA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
| SMILES |
CCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Rhodomelaceae | Acantophora spicifera | Ref. |
| Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Amaranthaceae | Celosia cristada | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Asphodelaceae | Aloe vera var.chinensis  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Neolitsea aciculata | Ref. |
| Plantae | Lauraceae | Neolitsea sericea | Ref. |
| Plantae | Lythraceae | Cuphea carthagenensis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Elaeis guineensis  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Primulaceae | Primula ovalifolia | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Ulmaceae | Holoptelea integrifolia  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Poria cocos  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|