| Name |
(E)-p-Coumaric acid trans-4-Hydroxycinnamic acid trans-p-Coumaric acid trans-p-Hydroxycinnamic acid |
| Formula |
C9H8O3 |
| Mw |
164.04734412 |
| CAS RN |
501-98-4 |
| C_ID |
C00000580
, 
|
| InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
| InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
| SMILES |
O=C(O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Aralia elata  | Ref. |
| Plantae | Asteraceae | Helianthus tuberosus  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Brassicaceae | Wasabia japonica  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus aureus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C.DC. | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Scrophularia huergeriana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|