| Name |
Sugiol
(+)-Sugiol |
| Formula |
C20H28O2 |
| Mw |
300.20893014 |
| CAS RN |
511-05-7 |
| C_ID |
C00031398
, 
|
| InChIKey |
IPEHJNRNYPOFII-HOFUVJEBNA-N |
| InChICode |
InChI=1S/C20H28O2/c1-12(2)13-9-14-15(10-16(13)21)20(5)8-6-7-19(3,4)18(20)11-17(14)22/h9-10,12,18,21H,6-8,11H2,1-5H3/t18-,20+/m0/s1 |
| SMILES |
CC(C)c1cc2c(cc1O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia var.drupacea | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus wilsoniana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Juniperus brevifolia | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Cupressaceae | Juniperus formosana Hay.var.concolor Hay | Ref. |
| Plantae | Cupressaceae | Juniperus polycarpus var. seravschanica | Ref. |
| Plantae | Cupressaceae | Juniperus rigida | Ref. |
| Plantae | Cupressaceae | Libocedrus bidwillii | Ref. |
| Plantae | Cupressaceae | Thuja plicata | Ref. |
| Plantae | Cupressaceae | Thuja standishii | Ref. |
| Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
| Plantae | Labiatae | Salvia bracteata Banks and Sol. | Ref. |
| Plantae | Labiatae | Salvia candelabrum | Ref. |
| Plantae | Labiatae | Salvia przewalskii | Ref. |
| Plantae | Labiatae | Salvia recognita Fisch.et Mey. | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Meliaceae | Azadirachta indica | Ref. |
| Plantae | Podocarpaceae | Dacrydium cupressinum | Ref. |
| Plantae | Taxaceae | Taxus mairei | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
|
|
zoom in
| Organism | Clerodendron cyrtophyllum |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Lu, et al., APS, 26, (1991), 193.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
KUO, et al., Chem Pharm Bull, 50, (2002), 1607.
XU, et al., Chem Pharm Bull, 53, (2005), 1575.
Iwamoto, et al., Planta Med, 69, (2003), 69.
Hohmann, et al., Planta Med, 69, (2003), 254.
Politi, et al., Planta Med, 69, (2003), 468.
Costa-Lotufo, et al., Planta Med, 70, (2004), 180.
Schneider, et al., Planta Med, 70, (2004), 471 |
|---|
|
