| Name |
Harpagide |
| Formula |
C15H24O10 |
| Mw |
364.13694699 |
| CAS RN |
6926-08-5 |
| C_ID |
C00010569
, 
|
| InChIKey |
XUWSHXDEJOOIND-RPRUHXQENA-N |
| InChICode |
InChI=1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3/t6-,7+,8+,9+,10-,11+,12+,13-,14-,15-/m0/s1 |
| SMILES |
C[C@]1(O)C[C@@H](O)[C@]2(O)C=COC(OC3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ajuga pyramidalis | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Labiatae | Caryopteris x Clandonensis | Ref. |
| Plantae | Labiatae | Lamium galeobdolon L. ssp. galeobdolon | Ref. |
| Plantae | Labiatae | Melittis melissophyllum  | Ref. |
| Plantae | Labiatae | Stachys atherocalyx | Ref. |
| Plantae | Labiatae | Stachys grossheimii | Ref. |
| Plantae | Labiatae | Stachys iberica | Ref. |
| Plantae | Labiatae | Stachys lavandullillia | Ref. |
| Plantae | Labiatae | Stachys spectabilis | Ref. |
| Plantae | Labiatae | Stachys sylvatica | Ref. |
| Plantae | Lamiaceae | Betonica macrantha | Ref. |
| Plantae | Lamiaceae | Betonica nivea | Ref. |
| Plantae | Lamiaceae | Betonica occidentalis | Ref. |
| Plantae | Lamiaceae | Betonica officinalis  | Ref. |
| Plantae | Lamiaceae | Lamiastrum galeobdolon flavidum(L.)Ehrend et Polatschek. | Ref. |
| Plantae | Pedaliaceae | Harpagophytum prucumbens D.C. | Ref. |
| Plantae | Poaceae | Tribolium castaneum | Ref. |
| Plantae | Scrophulariaceae | Oreosolen wattii | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia cryptophila | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scorodonia | Ref. |
|
|
zoom in
| Organism | Scrophularia cryptophila | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|