| Name |
Procyanidin B3 Catechin-(4alpha->8)-catechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
23567-23-9 |
| C_ID |
C00009071
, 
|
| InChIKey |
XFZJEEAOWLFHDH-KJNMLZBZNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula pubescens  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ericaceae | Calluna vulgaris  | Ref. |
| Plantae | Ericaceae | Pyrola incarnata | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Pinaceae | Larix gmelini | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Fragaria spp. | Ref. |
| Plantae | Rosaceae | Potentilla viscosa | Ref. |
| Plantae | Rosaceae | Rosa cymosa | Ref. |
| Plantae | Rosaceae | Rosa henryi | Ref. |
| Plantae | Rosaceae | Rosa laevigata  | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Salicaceae | Populus canescens | Ref. |
| Plantae | Salicaceae | Salix caprea  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Saxifragaceae | Bergenia purpurascens | Ref. |
| Plantae | Theaceae | Camellia japonica  | Ref. |
| Plantae | Theaceae | Camellia sinensis var.assamica  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Salix daphnoides | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|