| Name |
(-)-Epigallocatechin Epigallocatechin L-Epigallocatechin l-Epigallocatechin |
| Formula |
C15H14O7 |
| Mw |
306.0739528 |
| CAS RN |
970-74-1 |
| C_ID |
C00008818
, 
|
| InChIKey |
XMOCLSLCDHWDHP-JTFITGRYNA-N |
| InChICode |
InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Salacia prinoides | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare | Ref. |
| Plantae | Combretaceae | Terminalia arjuna | Ref. |
| Plantae | Combretaceae | Terminalia catappa | Ref. |
| Plantae | Combretaceae | Terminalia mollis | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri | Ref. |
| Plantae | Fabaceae | Acacia nilotica | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Pisum sativum | Ref. |
| Plantae | Fabaceae | Stryphnodendron adstringens | Ref. |
| Plantae | Fabaceae | Trifolium repens | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Malvaceae | Guazuma ulmifolia | Ref. |
| Plantae | Meliaceae | Azadirachta indica | Ref. |
| Plantae | Myricaceae | Myrica rubra | Ref. |
| Plantae | Myrtaceae | Syzygium spp. | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L. | Ref. |
| Plantae | Palmae | Cocos nucifera | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
| Organism | Acacia pennatula | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|