| Name |
Naringenin chalcone Chalconaringenin Isosalipurpol trans-2',4,4',6'-Tetrahydroxychalcone (2E)- 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-Propen-1-one |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
25515-46-2 |
| C_ID |
C00007233
, 
|
| InChIKey |
YQHMWTPYORBCMF-ZZXKWVIFSA-N |
| InChICode |
InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H/b6-3+ |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)c1c(O)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Cannabaceae | Cannabis indica | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Liliaceae | Tulipa sp. | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Salicaceae | Populus angustifolia | Ref. |
| Plantae | Salicaceae | Populus sieboldii | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Populus sieboldii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
de Vlaming,Phytochem.,15,(1976),348
Wollenweber,Z.Naturforsch.C.,34,(1979),1289 |
|---|
|