| Name |
Astragalin Kaempferol 3-O-beta-D-glucoside Kaempferol 3-glucoside Kaempferol 3-O-beta-D-glucopyranoside Kaempferol 3-O-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
480-10-4 |
| C_ID |
C00005138
, 
|
| InChIKey |
JPUKWEQWGBDDQB-UNCWLGIWNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Alliaceae | Allium porrum L.  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona crassiflora  | Ref. |
| Plantae | Annonaceae | Bocagea sp.nov. | Ref. |
| Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
| Plantae | Annonaceae | Duguetia chrysocarpa | Ref. |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Annonaceae | Guatteria villosissima | Ref. |
| Plantae | Annonaceae | Rollinia dolabripetala | Ref. |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Apiaceae | Ammi majus L.  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Carum carvi  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Solenostemma argel  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asteraceae | Arnica montana cv.ARBO  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Asteraceae | Gerbera jamesonii | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Haplopappus foliosus | Ref. |
| Plantae | Asteraceae | Helichrysum graveolen | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
| Plantae | Asteraceae | Solidago altissima | Ref. |
| Plantae | Asteraceae | Zinnia elegans | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
| Plantae | Blechnaceae | Stenochlaena palustris | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Brassicaceae | Hirschfeldia incana  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Chloranthaceae | Ascarina lucida | Ref. |
| Plantae | Convolvulaceae | Evolvulus alsinoides  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Marah oreganus | Ref. |
| Plantae | Cupressaceae | Juniperus macropoda | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ericaceae | Pyrola spp. | Ref. |
| Plantae | Euphorbiaceae | Euphorbia chamaesyce | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
| Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
| Plantae | Euphorbiaceae | Sapium haematospermum  | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Fabaceae | Astragalus dipelta | Ref. |
| Plantae | Fabaceae | Astragalus sp. | Ref. |
| Plantae | Fabaceae | Astragalus spp. | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bauhinia variegata L.  | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Lupinus albus L.  | Ref. |
| Plantae | Fabaceae | Onobrychis amoena | Ref. |
| Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
| Plantae | Fabaceae | Onobrychis chlorassanica | Ref. |
| Plantae | Fabaceae | Onobrychis echidna | Ref. |
| Plantae | Fabaceae | Onobrychis ferganica | Ref. |
| Plantae | Fabaceae | Onobrychis grandis | Ref. |
| Plantae | Fabaceae | Onobrychis seravschanica | Ref. |
| Plantae | Fabaceae | Ononis leiosperma | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tephrosia calophylla | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Gesneriaceae | Saintpaulia ionatha | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Crocus antalyensis | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Leonurus persicus | Ref. |
| Plantae | Labiatae | Phlomis caucasica | Ref. |
| Plantae | Labiatae | Phlomis spectabilis | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Labiatae | Salvia cavaleriei | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium barbadense  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Moraceae | Morus alba L.  | Ref. |
| Plantae | Moraceae | Morus insignis | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea stellata  | Ref. |
| Plantae | Ochnaceae | Ochna beddomei  | Ref. |
| Plantae | Ochnaceae | Ochna obtusata | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Nyctanthes arbortristis  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Podocarpaceae | Podocarpus nivalis | Ref. |
| Plantae | Polygonaceae | Polygonum salicifolium  | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Ranunculaceae | Pulsatilla cernua  | Ref. |
| Plantae | Rosaceae | Agrimonia eupatoria  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
| Plantae | Rutaceae | Haplophyllum glabrinum | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Salicaceae | Salix raddeana | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum elaeagnifolium  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Thelypteridaceae | Phegopteris connectilis | Ref. |
| Plantae | Thelypteridaceae | Thelypteris nipponica | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zygophyllaceae | Tribulus alatus Del.  | Ref. |
|
|
zoom in
| Organism | Gerbera jamesonii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nakabayashi,J.Agr.Chem.Soc.Japan,26,(1952),539 |
|---|
|