| Name |
5-Hydroxy-3,7,3',4'-tetramethoxyflavone Retusin(Ariocarpus) Quercetin 3,7,3',4'-tetramethyl ether Retusine 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one Retusin |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
1245-15-4 |
| C_ID |
C00004653
, 
|
| InChIKey |
HHGPYJLEJGNWJA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia rupestris | Ref. |
| Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
| Plantae | Asteraceae | Grindelia nana | Ref. |
| Plantae | Asteraceae | Grindelia tenella | Ref. |
| Plantae | Asteraceae | Parthenium spp. | Ref. |
| Plantae | Asteraceae | Urolepis hecatantha | Ref. |
| Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Boraginaceae | Cordia multispicata  | Ref. |
| Plantae | Cactaceae | Ariocarpus retusus | Ref. |
| Plantae | Crassulaceae | Aeonium lindleyi | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
| Plantae | Fabaceae | Dalbergia retusa | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum L.  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Orchidaceae | Spiranthes australis (R.BROWN) LINDL. | Ref. |
| Plantae | Phyllanthaceae | Bridelia ferruginea  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Evodia merrillii | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Solanaceae | Solanum paludosum  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Larrea cuneifolia  | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Siegesbeckia jorullensis | Ref. |
| - | - | Siegesbeckia orientalis  | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|