| Name |
5,4'-Dihydroxy-6,7,8-trimethoxyflavone Xanthomicrol 5-Hydroxy-2-(4-hydroxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
16545-23-6 |
| C_ID |
C00003879
, 
|
| InChIKey |
SAMBWAJRKKEEOR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-16-14(21)13-11(20)8-12(9-4-6-10(19)7-5-9)25-15(13)17(23-2)18(16)24-3/h4-8,19,21H,1-3H3 |
| SMILES |
COc1c(OC)c(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
| Plantae | Asteraceae | Baccharis patens | Ref. |
| Plantae | Asteraceae | Bracteantha viscosa | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Varthemia iphionoides  | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Cunila incana | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Nepeta spp. | Ref. |
| Plantae | Labiatae | Ocimum americanum L.var.americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum gratissimum  | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Satureja douglasii | Ref. |
| Plantae | Labiatae | Satureja montana  | Ref. |
| Plantae | Labiatae | Sideritis dasygnaphala | Ref. |
| Plantae | Labiatae | Sideritis spp. | Ref. |
| Plantae | Labiatae | Thymus herba-barona  | Ref. |
| Plantae | Labiatae | Thymus spp. | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Phytolaccaceae | Phytolacca americana  | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Rutaceae | Citrus sudachii | Ref. |
|
|
zoom in
| Organism | Origanum vulgare subsp. Glandulosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|