| Name |
Isoacteoside Isoverbascoside |
| Formula |
C29H36O15 |
| Mw |
624.20542048 |
| CAS RN |
61303-13-7 |
| C_ID |
C00030516
, 
|
| InChIKey |
FNMHEHXNBNCPCI-HLHSQOBJNA-N |
| InChICode |
InChI=1S/C29H36O15/c1-13-22(35)24(37)25(38)29(42-13)44-27-23(36)20(12-41-21(34)7-4-14-2-5-16(30)18(32)10-14)43-28(26(27)39)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27-,28+,29-/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](OCCc3ccc(O)c(O)c3)O[C@H](COC(=O)/C=C/c3ccc(O)c(O)c3)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Barleria strigosa  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Bignoniaceae | Barnettia kerrii | Ref. |
| Plantae | Bignoniaceae | Dolichandrone serrulata | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Bignoniaceae | Markhamia lutea  | Ref. |
| Plantae | Bignoniaceae | Markhamia stipulata  | Ref. |
| Plantae | Bignoniaceae | Stereospermum cylindricum  | Ref. |
| Plantae | Celastraceae | Maytenus loevis | Ref. |
| Plantae | Fabaceae | Bauhinia tarapotensis | Ref. |
| Plantae | Globulariaceae | Globularia davisiana | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Lamium purpureum L.  | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Oleaceae | Fraxinus ornus  | Ref. |
| Plantae | Orobanchaceae | Orobanche coerulescens  | Ref. |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
| Plantae | Verbenaceae | Verbena littoralis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| - | - | Pithecotenium crucigerum (L.) A.H Gentry | Ref. |
|
|
zoom in
| Organism | Orobanche coerulescens | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
HARPUT, et al., Chem Pharm Bull, 50, (2002), 869.
ONO, et al., Chem Pharm Bull, 53, (2005), 1175.
Lin, et al., Planta Med, 70, (2004), 50.
Kirmizibekmez, et al., Planta Med, 70, (2004), 711.
Boje, et al., Planta Med, 69, (2003), 820 |
|---|
|