| Name |
Cirsilineol Anisomelin Eupatrin Fastigenin 5,4'-Dihydroxy-6,7,3'-trimethoxyflavone |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
41365-32-6 |
| C_ID |
C00013595
, 
|
| InChIKey |
VKOSQMWSWLZQPA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia herba-alba  | Ref. |
| Plantae | Asteraceae | Artemisia oliveriana | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Asteraceae | Blumea lacera  | Ref. |
| Plantae | Asteraceae | Centaurea macrocephala | Ref. |
| Plantae | Asteraceae | Cirsium lineare | Ref. |
| Plantae | Asteraceae | Heterotheca grandiflora | Ref. |
| Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
| Plantae | Asteraceae | Palafoxia sphacelata | Ref. |
| Plantae | Bignoniaceae | Tecomella undulata  | Ref. |
| Plantae | Bromeliaceae | Tillandsia utriculata | Ref. |
| Plantae | Labiatae | Hyssopus officinalis  | Ref. |
| Plantae | Labiatae | Lycopus europaeus  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicum L.  | Ref. |
| Plantae | Labiatae | Ocimum spp. | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum L.  | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Sideritis mugronensis | Ref. |
| Plantae | Labiatae | Sideritis spp. | Ref. |
| Plantae | Labiatae | Teucrium alyssifolium | Ref. |
| Plantae | Labiatae | Teucrium marum  | Ref. |
| Plantae | Labiatae | Thymus herba-barona  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Labiatae | Ziziphora hispanica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Verbenaceae | Lippia citriodora  | Ref. |
|
|
zoom in
| Organism | Origanum majorana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|