| Name |
Geniposidic acid |
| Formula |
C16H22O10 |
| Mw |
374.12129692 |
| CAS RN |
27741-01-1 |
| C_ID |
C00010564
, 
|
| InChIKey |
ZJDOESGVOWAULF-VOANPPFUNA-N |
| InChICode |
InChI=1S/C16H22O10/c17-3-6-1-2-7-8(14(22)23)5-24-15(10(6)7)26-16-13(21)12(20)11(19)9(4-18)25-16/h1,5,7,9-13,15-21H,2-4H2,(H,22,23)/t7-,9-,10-,11-,12+,13+,15+,16-/m1/s1 |
| SMILES |
O=C(O)C1=CO[C@@H](O[C@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@@H]2C(CO)=CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Avicennia officinalis L.  | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Labiatae | Gmelina philippensis  | Ref. |
| Plantae | Orobanchaceae | Cistanche tubulosa  | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Plantaginaceae | Erinus alpinus | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago bellardi | Ref. |
| Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago raoulii | Ref. |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Rubiaceae | Adina polycephala Benth | Ref. |
| Plantae | Rubiaceae | Canthium berberidifolium | Ref. |
| Plantae | Rubiaceae | Galium rivale | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Rubiaceae | Genipa americana  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|