| Name |
Gardoside |
| Formula |
C16H22O10 |
| Mw |
374.12129692 |
| CAS RN |
54835-76-6 |
| C_ID |
C00010556
, 
|
| InChIKey |
JSKCJJNYSGWZDU-FCFLFJHTNA-N |
| InChICode |
InChI=1S/C16H22O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4,6,8-13,15-21H,1-3H2,(H,22,23)/t6-,8+,9-,10-,11-,12-,13+,15+,16+/m1/s1 |
| SMILES |
C=C1[C@H]2[C@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)OC=C(C(=O)O)[C@H]2C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gaillardia jasminoides | Ref. |
| Plantae | Globulariaceae | Globularia vulgaris L. | Ref. |
| Plantae | Labiatae | Gmelina philippensis  | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Orobanchaceae | Pedicularis bracteosa | Ref. |
| Plantae | Orobanchaceae | Pedicularis crenulata | Ref. |
| Plantae | Orobanchaceae | Pedicularis groenlandica | Ref. |
| Plantae | Orobanchaceae | Pedicularis procera | Ref. |
| Plantae | Orobanchaceae | Pedicularis racemosa | Ref. |
| Plantae | Plantaginaceae | Lafuentea rotundifolia | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago altissima  | Ref. |
| Plantae | Plantaginaceae | Plantago arborescens | Ref. |
| Plantae | Plantaginaceae | Plantago atrata | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago raoulii | Ref. |
| Plantae | Plantaginaceae | Plantago stauntonii | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Plantaginaceae | Veronica beccabunga  | Ref. |
| Plantae | Plantaginaceae | Veronica derwentiana | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Veronica salicifolia G. Forst. | Ref. |
| Plantae | Plantaginaceae | Wulfenia blechicii Lakusic subsp. | Ref. |
| Plantae | Plantaginaceae | Wulfenia orientalis BOISS. | Ref. |
| Plantae | Rubiaceae | Adina polycephala Benth | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Veronica derwentiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|