| Name |
Neoxanthin Folioxanthin |
| Formula |
C40H56O4 |
| Mw |
600.41786028 |
| CAS RN |
14660-91-4 |
| C_ID |
C00003780
, 
|
| InChIKey |
PGYAYSRVSAJXTE-ALKGEJJMNA-N |
| InChICode |
InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35-36(5,6)25-33(41)27-38(35,9)43)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-21,23-24,33-34,41-43H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,24-23+,29-15+,30-16+,31-19+,32-20+/t22?,33-,34-,38+,39+,40-/m0/s1 |
| SMILES |
C/C(C=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=C[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Tagetes erecta L.  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica rapa ssp. chinensis  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora edulis  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Potamogetonaceae | Potamogeton perfoliatus  | Ref. |
| Plantae | Ranunculaceae | Caltha palustris  | Ref. |
| Plantae | Rosaceae | Geum spp. | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Prunus domestica  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Prunus domestica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter60 |
|---|
|