| Name |
Loganin |
| Formula |
C17H26O10 |
| Mw |
390.15259705 |
| CAS RN |
18524-94-2 |
| C_ID |
C00003088
, 
|
| InChIKey |
AMBQHHVBBHTQBF-FJBRCSOCNA-N |
| InChICode |
InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@@H]2[C@@H](C)[C@@H](O)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica Thunb.  | Ref. |
| Plantae | -- | Lonicera quinquelocularis | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Caprifoliaceae | Patrinia villosa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asper | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa japonica | Ref. |
| Plantae | Gentianaceae | Centaurium erythraea  | Ref. |
| Plantae | Gentianaceae | Gentiana loureirii | Ref. |
| Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Gentianaceae | Gentiana verna | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
| Plantae | Longaniaceae | Strychnos ignatii  | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum hemsleyi Yamamoto | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis L.  | Ref. |
| Plantae | Oleaceae | Osmanthus austrocaledonicus (Vieill.) Knobl. | Ref. |
| Plantae | Oleaceae | Picconia excelsa (Aiton) DC. | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Calycophyllum spruceanum  | Ref. |
| Plantae | Rubiaceae | Neonauclea sessilifolia  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Verbenaceae | Lippia graveolens  | Ref. |
| - | - | Sertia mussotii | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|