| Name |
Anisaldehyde p-Anisaldehyde |
| Formula |
C8H8O2 |
| Mw |
136.0524295 |
| CAS RN |
123-11-5 |
| C_ID |
C00002636
, 
|
| InChIKey |
ZRSNZINYAWTAHE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3 |
| SMILES |
COc1ccc(C=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pleurotaceae | Pleurotus pulmonarius  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Osmorhiza aristata var.laxa.  | Ref. |
| Plantae | Apiaceae | Pimpinella anisum  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Fabaceae | Cassia spp. | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Illiciaceae | Illicium verum  | Ref. |
| Plantae | Labiatae | Agastache rugosa  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Magnoliaceae | Magnolia salicifolia  | Ref. |
| Plantae | Orchidaceae | Vanilla spp. | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Rutaceae | Pelea madagascariensis | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Ulva pertusa | Ref. |
|
|
zoom in
| Organism | Ulva pertusa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|