| Name |
Coumestrol Cumestrol 3,9-Dihydroxycoumestan Coumesterol |
| Formula |
C15H8O5 |
| Mw |
268.03717337 |
| CAS RN |
479-13-0 |
| C_ID |
C00002514
, 
|
| InChIKey |
ZZIALNLLNHEQPJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O5/c16-7-1-3-9-11(5-7)19-14-10-4-2-8(17)6-12(10)20-15(18)13(9)14/h1-6,16-17H |
| SMILES |
O=c1oc2cc(O)ccc2c2oc3cc(O)ccc3c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Fabaceae | Bituminaria morisiana | Ref. |
| Plantae | Fabaceae | Cullen corylifolium | Ref. |
| Plantae | Fabaceae | Dolichos biflorus  | Ref. |
| Plantae | Fabaceae | Glycine canescens | Ref. |
| Plantae | Fabaceae | Glycine clandestina | Ref. |
| Plantae | Fabaceae | Glycine falcata | Ref. |
| Plantae | Fabaceae | Glycine latifolia | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycine tabacina | Ref. |
| Plantae | Fabaceae | Glycine tomentella | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago spp. | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Trifolium fragiferum | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Fabaceae | Vigna unguiculata  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
|
|
zoom in
| Organism | Phaseolus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Bickoff,J.Am.Chem.Soc.,80,(1958),3969
Dewick,Phytochem.,9,(1970),775 |
|---|
|