| Name |
Galantamine Galanthamine (-)-Galanthamine Jilkon Lycoremin Lycoremine |
| Formula |
C17H21NO3 |
| Mw |
287.15214354 |
| CAS RN |
357-70-0 |
| C_ID |
C00001570
, 
|
| InChIKey |
ASUTZQLVASHGKV-KJOHYSOBNA-N |
| InChICode |
InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
| SMILES |
COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Crinum spp. | Ref. |
| Plantae | Amaryllidaceae | Cyrtanthus elatus | Ref. |
| Plantae | Amaryllidaceae | Galanthus caucasicus  | Ref. |
| Plantae | Amaryllidaceae | Galanthus elewesii | Ref. |
| Plantae | Amaryllidaceae | Galanthus elwesii Hook. | Ref. |
| Plantae | Amaryllidaceae | Galanthus nivalis  | Ref. |
| Plantae | Amaryllidaceae | Galanthus spp. | Ref. |
| Plantae | Amaryllidaceae | Galanthus woronowii Losinsk.  | Ref. |
| Plantae | Amaryllidaceae | Hippeastrum spp. | Ref. |
| Plantae | Amaryllidaceae | Hymenocallis spp. | Ref. |
| Plantae | Amaryllidaceae | Leucojum aestivum  | Ref. |
| Plantae | Amaryllidaceae | Leucojum spp. | Ref. |
| Plantae | Amaryllidaceae | Leucojum vernum | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata Herb.  | Ref. |
| Plantae | Amaryllidaceae | Lycoris sanguinea | Ref. |
| Plantae | Amaryllidaceae | Lycoris spp. | Ref. |
| Plantae | Amaryllidaceae | Narcissus confusus | Ref. |
| Plantae | Amaryllidaceae | Narcissus pseudonarcissus subsp.pseudonarcissus | Ref. |
| Plantae | Amaryllidaceae | Narcissus spp. | Ref. |
| Plantae | Amaryllidaceae | Pancratium spp. | Ref. |
| Plantae | Amaryllidaceae | Ungernia spp. | Ref. |
| Plantae | Nitrariaceae | Peganum harmala  | Ref. |
|
|
zoom in
| Organism | Peganum harmala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|