| Name |
alpha-Guaiene Guaia-1(5),11-diene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
3691-12-1 |
| C_ID |
C00020377
, 
|
| InChIKey |
ADIDQIZBYUABQK-JKEUNINMNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@H](C)C2=C(C1)[C@@H](C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Jubulaceae | Frullania anomala | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Bulnesia sarmienti | Ref. |
| - | - | Postegmon patchouli | Ref. |
|
|
zoom in
| Organism | Primula halleri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|