| Name |
1-epi-Cubenol (+)-ent-Epicubenol epi-Cubenol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
81939-29-9 |
| C_ID |
C00020146
, 
|
| InChIKey |
COGPRPSWSKLKTF-FKKFEIHGNA-N |
| InChICode |
InChI=1S/C15H26O/c1-10(2)13-6-5-12(4)15(16)8-7-11(3)9-14(13)15/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14+,15+/m0/s1 |
| SMILES |
CC1=C[C@@H]2[C@@H](C(C)C)CC[C@H](C)[C@]2(O)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Chamaecyparis obtusa var.formosana | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Pinaceae | Cedrus atlantica Manetii | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Scapaniaceae | Scapania undulata | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| - | - | Cabralea toona | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|