| Name |
Delphin Delphinidin 3,5-diglucoside |
| Formula |
C27H31O17 |
| Mw |
627.15612457 |
| CAS RN |
17670-06-3 |
| C_ID |
C00006709
, 
|
| InChIKey |
XCTGXGVGJYACEI-JHPRFTIFNA-O |
| InChICode |
InChI=1S/C27H30O17/c28-6-16-19(34)21(36)23(38)26(43-16)41-14-4-9(30)3-13-10(14)5-15(25(40-13)8-1-11(31)18(33)12(32)2-8)42-27-24(39)22(37)20(35)17(7-29)44-27/h1-5,16-17,19-24,26-29,34-39H,6-7H2,(H3-,30,31,32,33)/p+1/t16-,17+,19-,20-,21+,22-,23-,24+,26-,27-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Boraginaceae | Lobostemon spp. | Ref. |
| Plantae | Convolvulaceae | Evolvulus pilosus | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus aureus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
| Plantae | Iridaceae | Crocus antalyensis | Ref. |
| Plantae | Iridaceae | Crocus sieberi | Ref. |
| Plantae | Labiatae | Salvia spp.  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Orchidaceae | Orchis sp. | Ref. |
| Plantae | Passifloraceae | Passiflora quadrangularis  | Ref. |
| Plantae | Plantaginaceae | Penstemon spp. | Ref. |
| Plantae | Plumbaginaceae | Limonium spp. | Ref. |
| Plantae | Poaceae | Nardus stricta | Ref. |
| Plantae | Ranunculaceae | Anemone hepatica  | Ref. |
| Plantae | Ranunculaceae | Delphinium consolida  | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Anemone hepatica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann,408,(1915),61 |
|---|
|