| Name |
Miquelianin Quercetin 3-O-beta-D-glucuronide Quercetin 3-O-glucuronide Quercetin 3-O-beta-D-glucuronopyranoside |
| Formula |
C21H18O13 |
| Mw |
478.07474066 |
| CAS RN |
22688-79-5 |
| C_ID |
C00005376
, 
|
| InChIKey |
DUBCCGAQYVUYEU-NTEJZTTHNA-N |
| InChICode |
InChI=1S/C21H18O13/c22-7-4-10(25)12-11(5-7)32-17(6-1-2-8(23)9(24)3-6)18(13(12)26)33-21-16(29)14(27)15(28)19(34-21)20(30)31/h1-5,14-16,19,21-25,27-29H,(H,30,31)/t14-,15+,16+,19+,21-/m1/s1 |
| SMILES |
O=C(O)[C@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anethum sowa  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Orlaya spp. Lasthenia spp. | Ref. |
| Plantae | Asteraceae | Arnica chamissonis | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Stephanodoria tomentella | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Ericaceae | Gaultheria miqueliana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Geraniaceae | Geranium dissectum  | Ref. |
| Plantae | Geraniaceae | Monsonia spp. | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Labiatae | Salvia blepharophylla | Ref. |
| Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
| Plantae | Malvaceae | Theobroma grandiflorum | Ref. |
| Plantae | Myrtaceae | Psidium guaijava | Ref. |
| Plantae | Onagraceae | Fuchsia fulgens | Ref. |
| Plantae | Philydraceae | Philydrum lanuginosum | Ref. |
| Plantae | Polygonaceae | Eriogonum nudum | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper L.  | Ref. |
| Plantae | Polygonaceae | Polygonum perfoliatum | Ref. |
| Plantae | Polygonaceae | Polygonum salicifolium  | Ref. |
| Plantae | Polygonaceae | Polygonum viviparum  | Ref. |
| Plantae | Pteridaceae | Adiantum spp. | Ref. |
| Plantae | Rosaceae | Rosa luciae | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Salicaceae | Populus grandidentata | Ref. |
| Plantae | Zingiberaceae | Alpinia elatior | Ref. |
| Plantae | Zingiberaceae | Cautleya spicata | Ref. |
| Plantae | Zingiberaceae | Hedychium thyrsiforme | Ref. |
|
|
zoom in
| Organism | Philydrum lanuginosum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Sasaki,J.Pharm.Soc.Japan,76,(1956),1893
Wagner,ChemBer.,103,(1970),3674 |
|---|
|