| Name |
5-Hydroxy-6,7,3',4'-tetramethoxyflavone 6-Hydroxyluteolin 6,7,3',4'-tetramethyl ether 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
21763-80-4 |
| C_ID |
C00003898
, 
|
| InChIKey |
QEWSAPKRFOFQIU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea conferta | Ref. |
| Plantae | Asteraceae | Achillea santolina  | Ref. |
| Plantae | Asteraceae | Ageratina pichinchensis | Ref. |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Asteraceae | Artemisia austriaca | Ref. |
| Plantae | Asteraceae | Artemisia giraldii | Ref. |
| Plantae | Asteraceae | Artemisia mongolica | Ref. |
| Plantae | Asteraceae | Artemisia sieversiana  | Ref. |
| Plantae | Asteraceae | Artemisia verlotiorum | Ref. |
| Plantae | Asteraceae | Brickellia scoparia | Ref. |
| Plantae | Asteraceae | Centaurea granata | Ref. |
| Plantae | Asteraceae | Centaurea macrocephala | Ref. |
| Plantae | Asteraceae | Chromolaena arnottiana | Ref. |
| Plantae | Asteraceae | Eupatorium altissimum | Ref. |
| Plantae | Asteraceae | Eupatorium microphyllum | Ref. |
| Plantae | Asteraceae | Lagophylla glandulosa | Ref. |
| Plantae | Asteraceae | Parthenium incanum | Ref. |
| Plantae | Asteraceae | Tanacetum santolinioides | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Cunila incana | Ref. |
| Plantae | Labiatae | Isodon leucophyllus | Ref. |
| Plantae | Labiatae | Mentha longifolia  | Ref. |
| Plantae | Labiatae | Mentha piperita L.var.kubamskaya  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Ocimum americanum var. americanum  | Ref. |
| Plantae | Labiatae | Orthosiphon aristatus  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia dominica | Ref. |
| Plantae | Labiatae | Salvia macrosiphon | Ref. |
| Plantae | Labiatae | Salvia mirzayani | Ref. |
| Plantae | Labiatae | Salvia syriaca | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Sideritis angustifolia | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Teucrium alyssifolium | Ref. |
| Plantae | Labiatae | Teucrium botrys | Ref. |
| Plantae | Labiatae | Teucrium pseudochamaepitys | Ref. |
| Plantae | Labiatae | Ziziphora hispanica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus tangerina  | Ref. |
| Plantae | Rutaceae | Merrillia caloxylon | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
|
|
zoom in
| Organism | Isodon leucophyllus | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Zhao, et al., Acta Botanica Yunnanica(Yunnan Zhiwu Yanjiu), 25, (2003), 503.
ONO, et al., Chem Pharm Bull, 53, (2005), 1175.
Seo, et al., Planta Med, 69, (2003), 218 |
|---|
|