| Name |
Dihydrosanguinarine |
| Formula |
C20H15NO4 |
| Mw |
333.10010798 |
| CAS RN |
3606-45-9 |
| C_ID |
C00001847
, 
|
| InChIKey |
CIUHLXZTZWTVFL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H15NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-7H,8-10H2,1H3 |
| SMILES |
CN1Cc2c(ccc3c2OCO3)-c2ccc3cc4c(cc3c21)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis bulbosa (L.) DC. | Ref. |
| Plantae | Fumariaceae | Corydalis bulleyana | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Corydalis gigantea | Ref. |
| Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey | Ref. |
| Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
| Plantae | Fumariaceae | Corydalis meifolia wall. | Ref. |
| Plantae | Fumariaceae | Corydalis paniculugera Rgl. | Ref. |
| Plantae | Fumariaceae | Corydalis remota Fisch. | Ref. |
| Plantae | Fumariaceae | Corydalis thyrsifolia | Ref. |
| Plantae | Fumariaceae | Corydalis vaginans Royle | Ref. |
| Plantae | Fumariaceae | Dicentra peregrina Rudolph | Ref. |
| Plantae | Fumariaceae | Dicentra spectabilis L. | Ref. |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora Lam  | Ref. |
| Plantae | Fumariaceae | Fumaria sepium | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Fumariaceae | Hypecoum leptocarpus | Ref. |
| Plantae | Fumariaceae | Sarcocapnos baetica | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Papaveraceae | Bocconia arborea | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Eschscholtzia californica Cham | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Glaucium bois | Ref. |
| Plantae | Papaveraceae | Glaucium flavum Cr.var.vestitum  | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Pteridophyllaceae | Pteridophyllum racemosum Sieb.et Zuce. | Ref. |
| Plantae | Pteridophyllaceae | Pteridophyllum spp. | Ref. |
| Plantae | Ranunculaceae | Coptis japonica  | Ref. |
| Plantae | Rutaceae | Fagara angolensis | Ref. |
|
|
zoom in
| Organism | Fumaria sepium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|