| Name |
Sciadopitysin |
| Formula |
C33H24O10 |
| Mw |
580.13694699 |
| CAS RN |
521-34-6 |
| C_ID |
C00001098
, 
|
| InChIKey |
YCXRBCHEOFVYEN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C33H24O10/c1-39-18-7-4-16(5-8-18)27-15-25(38)32-23(36)13-22(35)30(33(32)43-27)20-10-17(6-9-26(20)41-3)28-14-24(37)31-21(34)11-19(40-2)12-29(31)42-28/h4-15,34-36H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc(-c5cc(=O)c6c(O)cc(OC)cc6o5)ccc4OC)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Araucariaceae | Araucaria spp. | Ref. |
| Plantae | Boweniaceae | Bowenia spp. | Ref. |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus fortunei | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Cupressaceae | Juniperus horizontalis | Ref. |
| Plantae | Cupressaceae | Thujopsis spp. | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Podocarpaceae | Podocarpus macrophyllus  | Ref. |
| Plantae | Sciadopityaceae | Sciadopitys spp. | Ref. |
| Plantae | Sciadopityaceae | Sciadopitys verticillata | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus brevifolia  | Ref. |
| Plantae | Taxaceae | Taxus buccata | Ref. |
| Plantae | Taxaceae | Taxus canadensis | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Taxaceae | Torreya nucifera  | Ref. |
| Plantae | Taxaceae | Torreya yunnanensis | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Taxodiaceae | Taxodium mucronatum | Ref. |
| Plantae | Zamiaceae | Ceratozamia spp. | Ref. |
| Plantae | Zamiaceae | Dioon spp. | Ref. |
| Plantae | Zamiaceae | Encephalartos spp. | Ref. |
| Plantae | Zamiaceae | Lepidozamia spp. | Ref. |
| Plantae | Zamiaceae | Macrozamia spp. | Ref. |
| Plantae | Zamiaceae | Zamia spp. | Ref. |
|
|
zoom in
| Organism | Torreya yunnanensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., JNP, 66, (2003), 1002.
Fonseca, et al., Phytochemistry, 55, (2000), 575.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|