| Name |
Afzelechin |
| Formula |
C15H14O5 |
| Mw |
274.08412356 |
| CAS RN |
2545-00-8 |
| C_ID |
C00000937
, 
|
| InChIKey |
RSYUFYQTACJFML-UYWMCZCJNA-N |
| InChICode |
InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2/t13-,15+/m0/s1 |
| SMILES |
Oc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@@H]2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia chinensis  | Ref. |
| Plantae | Chchlospermaceae | Cochlospermum gillivraei | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Cassia abbreviata  | Ref. |
| Plantae | Fabaceae | Cassia javanica  | Ref. |
| Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Moraceae | Artocarpus fretessi Hassk | Ref. |
| Plantae | Moraceae | Artocarpus reticulatus Miq | Ref. |
| Plantae | Myrtaceae | Eucalyptus calophylla | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus fusca | Ref. |
| Plantae | Palmae | Desmoncus polyacanthos  | Ref. |
| Plantae | Palmae | Desmoncus polycanthus | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Rhizophoraceae | Cassipourea gummiflua | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Saxifragaceae | Bergenia ligulata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga ligulata | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Typhaceae | Typha capensis (Rohrb.) N. E. Br  | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
| Organism | Prunus persica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Hillis,Aust.J.Chem.,13,(1960),390
Hillis,Phytochem.,6,(1967),59 |
|---|
|