| Name |
(+)-Viniferol E |
| Formula |
C56H44O13 |
| Mw |
924.27819149 |
| CAS RN |
870555-67-2 |
| C_ID |
C00064592
|
| InChIKey |
SLSQRFIWGCSNDI-ZBYKJNIJSA-N |
| InChICode |
InChI=1S/C56H44O13/c57-33-9-1-27(2-10-33)53-49(31-17-37(61)21-38(62)18-31)43-23-41(45(65)25-47(43)67-53)51-52(56(30-7-15-36(60)16-8-30)69-55(51)29-5-13-35(59)14-6-29)42-24-44-48(26-46(42)66)68-54(28-3-11-34(58)12-4-28)50(44)32-19-39(63)22-40(64)20-32/h1-26,49-66H/t49-,50-,51+,52+,53+,54+,55-,56+/m0/s1 |
| SMILES |
Oc1ccc(C2Oc3cc(O)c(C4C(c5ccc(O)cc5)OC(c5ccc(O)cc5)C4c4cc5c(cc4O)OC(c4ccc(O)cc4)C5c4cc(O)cc(O)c4)cc3C2c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis labrusca | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Vitis labrusca |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
