| Name |
Vitisinol D |
| Formula |
C28H22O6 |
| Mw |
454.14163844 |
| CAS RN |
848985-82-0 |
| C_ID |
C00064574
|
| InChIKey |
SVSWTEAHRCVGAR-XJAAUWFPSA-N |
| InChICode |
InChI=1S/C28H22O6/c29-19-7-2-15(3-8-19)1-4-17-13-23(33)27-24(16-5-9-20(30)10-6-16)25(26(17)28(27)34)18-11-21(31)14-22(32)12-18/h1-14,24-27,29-32H/b4-1+/t24-,25-,26+,27-/m1/s1 |
| SMILES |
O=C1C=C(C=Cc2ccc(O)cc2)C2C(=O)C1C(c1ccc(O)cc1)C2c1cc(O)cc(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|