| Name |
Norapoatropine |
| Formula |
C16H19NO2 |
| Mw |
257.14157886 |
| CAS RN |
78886-97-2 |
| C_ID |
C00064537
|
| InChIKey |
RDIVNYCOUBHXRH-YIONKMFJSA-N |
| InChICode |
InChI=1S/C16H19NO2/c1-11(12-5-3-2-4-6-12)16(18)19-15-9-13-7-8-14(10-15)17-13/h2-6,13-15,17H,1,7-10H2/t13-,14+,15? |
| SMILES |
C=C(C(=O)OC1CC2CCC(C1)N2)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus desertorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|