| Name |
Niaziridin |
| Formula |
C14H17NO6 |
| Mw |
295.10558728 |
| CAS RN |
768398-63-6 |
| C_ID |
C00064533
|
| InChIKey |
HVBYLVXHDOGZHK-WBFOWJMUSA-N |
| InChICode |
InChI=1S/C14H17NO6/c1-7-11(17)12(18)13(19)14(20-7)21-10-3-2-8(4-5-15)6-9(10)16/h2-3,6-7,11-14,16-19H,4H2,1H3/t7-,11-,12+,13+,14-/m0/s1 |
| SMILES |
CC1OC(Oc2ccc(CC#N)cc2O)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala | Ref. |
|
|
zoom in
| Organism | Moringa stenopetala |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
