| Name |
Fumaritine N-oxide |
| Formula |
C20H21NO6 |
| Mw |
371.13688741 |
| CAS RN |
60604-88-8 |
| C_ID |
C00064430
|
| InChIKey |
GIGLNPLPIFRSFH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H21NO6/c1-21(24)6-5-11-7-16(25-2)14(22)8-13(11)20(21)9-12-3-4-15-18(27-10-26-15)17(12)19(20)23/h3-4,7-8,19,22-23H,5-6,9-10H2,1-2H3 |
| SMILES |
COc1cc2c(cc1O)C1(Cc3ccc4c(c3C1O)OCO4)[N+](C)([O-])CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora | Ref. |
|
|
zoom in
| Organism | Fumaria parviflora |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
