| Name |
dl-Bicuculline |
| Formula |
C20H17NO6 |
| Mw |
367.10558728 |
| CAS RN |
56083-00-2 |
| C_ID |
C00064410
|
| InChIKey |
IYGYMKDQCDOMRE-MSOLQXFVSA-N |
| InChICode |
InChI=1S/C20H17NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)17(21)18-11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18H,4-5,8-9H2,1H3/t17-,18+/m1/s1 |
| SMILES |
CN1CCc2cc3c(cc2C1C1OC(=O)c2c1ccc1c2OCO1)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria cilicica | Ref. |
| Plantae | Fumariaceae | Fumaria gaillardotii | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
|
|
zoom in
| Organism | Fumaria officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|