| Name |
Paprafumine |
| Formula |
C22H23NO8 |
| Mw |
429.14236672 |
| CAS RN |
169626-17-9 |
| C_ID |
C00064001
|
| InChIKey |
QTXGLTPKAWEPFB-FMQUCBEESA-N |
| InChICode |
InChI=1S/C22H23NO8/c1-23(2)7-6-12-8-16-17(30-10-29-16)9-14(12)20(25)19(24)13-4-5-15-21(31-11-28-15)18(13)22(26)27-3/h4-5,8-9,24-25H,6-7,10-11H2,1-3H3/b20-19+ |
| SMILES |
COC(=O)c1c(C(O)=C(O)c2cc3c(cc2CCN(C)C)OCO3)ccc2c1OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
|
|
zoom in
| Organism | Fumaria parviflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|