| Name |
Ruberythric acid |
| Formula |
C25H26O13 |
| Mw |
534.13734092 |
| CAS RN |
152-84-1 |
| C_ID |
C00063920
|
| InChIKey |
GCGGSVAWTYHZBI-CVQRFVFPSA-N |
| InChICode |
InChI=1S/C25H26O13/c26-12-7-35-24(22(33)18(12)29)36-8-14-20(31)21(32)23(34)25(38-14)37-13-6-5-11-15(19(13)30)17(28)10-4-2-1-3-9(10)16(11)27/h1-6,12,14,18,20-26,29-34H,7-8H2/t12-,14-,18+,20-,21+,22-,23-,24+,25-/m1/s1 |
| SMILES |
O=C1c2ccccc2C(=O)c2c1ccc(OC1OC(COC3OCC(O)C(O)C3O)C(O)C(O)C1O)c2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum | Ref. |
|
|
zoom in
| Organism | Rubia tinctorum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
