| Name |
5-Hydroxyaloin A |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
138373-23-6 |
| C_ID |
C00063835
|
| InChIKey |
LJCDCYLYUCZUGL-UQBALUMJSA-N |
| InChICode |
InChI=1S/C21H22O10/c22-5-7-3-8-13(11(26)4-7)18(28)16-10(25)2-1-9(24)15(16)14(8)21-20(30)19(29)17(27)12(6-23)31-21/h1-4,12,14,17,19-27,29-30H,5-6H2/t12-,14-,17-,19+,20-,21+/m1/s1 |
| SMILES |
O=C1c2c(O)cc(CO)cc2C(C2OC(CO)C(O)C(O)C2O)c2c(O)ccc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe microstigma | Ref. |
| Plantae | Asphodelaceae | Aloe rupestris | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
|
|
zoom in
| Organism | Aloe rupestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|