| Name |
(-)-8-Methoxydihydrosanguinarine |
| Formula |
C21H17NO5 |
| Mw |
363.11067266 |
| CAS RN |
1194396-25-2 |
| C_ID |
C00063697
|
| InChIKey |
MHPDDMNAUJQRSW-OAQYLSRUSA-N |
| InChICode |
InChI=1S/C21H17NO5/c1-22-19-13(4-3-11-7-16-17(8-14(11)19)26-9-25-16)12-5-6-15-20(27-10-24-15)18(12)21(22)23-2/h3-8,21H,9-10H2,1-2H3/t21-/m1/s1 |
| SMILES |
COC1c2c(ccc3c2OCO3)-c2ccc3cc4c(cc3c2N1C)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
|
|
zoom in
| Organism | Fumaria parviflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|