| Name |
Scropolioside A |
| Formula |
C35H44O18 |
| Mw |
752.25276461 |
| CAS RN |
116064-68-7 |
| C_ID |
C00063677
|
| InChIKey |
RRBUKTFTHGQFCF-MLFNGFKZSA-N |
| InChICode |
InChI=1S/C35H44O18/c1-15-27(47-16(2)38)29(50-22(40)10-7-18-5-8-19(44-4)9-6-18)30(48-17(3)39)34(46-15)51-28-20-11-12-45-32(23(20)35(14-37)31(28)53-35)52-33-26(43)25(42)24(41)21(13-36)49-33/h5-12,15,20-21,23-34,36-37,41-43H,13-14H2,1-4H3/b10-7+/t15-,20+,21+,23+,24+,25-,26+,27-,28-,29+,30+,31-,32-,33-,34-,35+/m0/s1 |
| SMILES |
COc1ccc(C=CC(=O)OC2C(OC(C)=O)C(C)OC(OC3C4C=COC(OC5OC(CO)C(O)C(O)C5O)C4C4(CO)OC34)C2OC(C)=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia auriculata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
|
|
zoom in
| Organism | Scrophularia scopolii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|