| Name |
Przewanoic acid A |
| Formula |
C30H46O4 |
| Mw |
470.33960996 |
| CAS RN |
113540-94-6 |
| C_ID |
C00063664
|
| InChIKey |
PKEQJOUCSZJCQC-RURNFIJHSA-N |
| InChICode |
InChI=1S/C30H46O4/c1-25(2)11-12-29(24(33)34)10-8-20-27(5)9-7-19-26(3,4)23(32)18(31)15-28(19,6)21(27)13-17-14-30(17,20)22(29)16-25/h8,17-19,21-23,31-32H,7,9-16H2,1-6H3,(H,33,34)/t17-,18-,19+,21+,22-,23-,27+,28+,29-,30-/m1/s1 |
| SMILES |
CC1(C)CCC2(C(=O)O)CC=C3C4(C)CCC5C(C)(C)C(O)C(O)CC5(C)C4CC4CC34C2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia bicolor | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
|
|
zoom in
| Organism | Salvia sclarea | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|