| Name |
Quercetin 3-O-rhamnoglucoside Quercetin-3-O-rhamnosyl glucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
29662-79-1 |
| C_ID |
C00061320
|
| InChIKey |
FYBMGZSDYDNBFX-GXPPAHCZSA-N |
| InChICode |
InChI=1S/C27H30O16/c1-8-17(33)20(36)22(38)26(39-8)43-25-21(37)18(34)15(7-28)41-27(25)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,25+,26-,27-/m0/s1 |
| SMILES |
CC1OC(OC2C(Oc3c(-c4ccc(O)c(O)c4)oc4cc(O)cc(O)c4c3=O)OC(CO)C(O)C2O)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
|
|
zoom in
| Organism | Polygonum lapathifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|