| Name |
3,6-Di-O-galloyl-D-glucose 3,6-Di-O-galloylglucose |
| Formula |
C20H20O14 |
| Mw |
484.08530535 |
| CAS RN |
13186-20-4 |
| C_ID |
C00059641
|
| InChIKey |
RINHWYYBAWQTFZ-MJSCVDMRSA-N |
| InChICode |
InChI=1S/C20H20O14/c21-5-13(26)18(34-20(32)8-3-11(24)16(29)12(25)4-8)17(30)14(27)6-33-19(31)7-1-9(22)15(28)10(23)2-7/h1-5,13-14,17-18,22-30H,6H2/t13-,14+,17+,18+/m0/s1 |
| SMILES |
O=CC(O)C(OC(=O)c1cc(O)c(O)c(O)c1)C(O)C(O)COC(=O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
|
|
zoom in
| Organism | Phyllanthus emblica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|