| Name |
(-)-Viniferal Viniferal |
| Formula |
C35H26O8 |
| Mw |
574.16276781 |
| CAS RN |
180413-42-7 |
| C_ID |
C00057975
|
| InChIKey |
DHTHKPNODOWMKF-VPIGGYNKSA-N |
| InChICode |
InChI=1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 |
| SMILES |
O=Cc1ccc2c(c1)[C@@H](c1cc(O)cc3c1[C@H](c1cc(O)cc(O)c1)[C@@H](c1ccc(O)cc1)O3)[C@H](c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|