| Name |
Neotigogenin |
| Formula |
C27H44O3 |
| Mw |
416.32904527 |
| CAS RN |
470-01-9 |
| C_ID |
C00057400
|
| InChIKey |
GMBQZIIUCVWOCD-PUHUBZITSA-N |
| InChICode |
InChI=1S/C27H44O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28H,5-15H2,1-4H3/t16-,17-,18-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| SMILES |
C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Solanaceae | Lycopersicon pimpinellifolium  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Tribulus terrestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|