| Name |
Niazirin |
| Formula |
C14H17NO5 |
| Mw |
279.11067266 |
| CAS RN |
122001-32-5 |
| C_ID |
C00056952
|
| InChIKey |
OBJREHLZEIEGDU-CNJBRALLSA-N |
| InChICode |
InChI=1S/C14H17NO5/c1-8-11(16)12(17)13(18)14(19-8)20-10-4-2-9(3-5-10)6-7-15/h2-5,8,11-14,16-18H,6H2,1H3/t8-,11-,12+,13+,14-/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](Oc2ccc(CC#N)cc2)[C@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa stenopetala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|