| Name |
1-Methylethyl tetradecanoate
Isopropyl myristate
Isopropyl tetradecanoate |
| Formula |
C17H34O2 |
| Mw |
270.25588033 |
| CAS RN |
110-27-0 |
| C_ID |
C00055954
|
| InChIKey |
AXISYYRBXTVTFY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3/h16H,4-15H2,1-3H3 |
| SMILES |
CCCCCCCCCCCCCC(=O)OC(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| Plantae | Taxaceae | Taxus baccata | Ref. |
|
|
zoom in
| Organism | Trifolium pratense |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
