| Name |
Hexyl benzoate |
| Formula |
C13H18O2 |
| Mw |
206.13067982 |
| CAS RN |
6789-88-4 |
| C_ID |
C00055911
|
| InChIKey |
UUGLJVMIFJNVFH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H18O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h5-7,9-10H,2-4,8,11H2,1H3 |
| SMILES |
CCCCCCOC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Oleaceae | Jasminum multiflorum | Ref. |
|
|
zoom in
| Organism | Jasminum multiflorum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
