| Name |
Schomburgbiphenyl B Doitungbiphenyl A |
| Formula |
C18H20O4 |
| Mw |
300.13615913 |
| CAS RN |
1638527-15-7 |
| C_ID |
C00055804
|
| InChIKey |
DEPMDNKIRJLXNM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H20O4/c1-11(2)4-9-14-15(12-5-7-13(19)8-6-12)10-16(20)17(21)18(14)22-3/h4-8,10,19-21H,9H2,1-3H3 |
| SMILES |
COc1c(O)c(O)cc(-c2ccc(O)cc2)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia spp | Ref. |
|
|
zoom in
| Organism | Garcinia spp | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|