| Name |
(E)-Nuciferol |
| Formula |
C15H22O |
| Mw |
218.16706532 |
| CAS RN |
1786-15-8 |
| C_ID |
C00055579
|
| InChIKey |
FXCIQPDJVYFUQG-GUVYXZIWSA-N |
| InChICode |
InChI=1S/C15H22O/c1-12-7-9-15(10-8-12)14(3)6-4-5-13(2)11-16/h5,7-10,14,16H,4,6,11H2,1-3H3/b13-5+/t14-/m0/s1 |
| SMILES |
C/C(=CCC[C@H](C)c1ccc(C)cc1)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|