| Name |
Syringaresinol |
| Formula |
C22H26O8 |
| Mw |
418.16276781 |
| CAS RN |
487-35-4 |
| C_ID |
C00053808
|
| InChIKey |
KOWMJRJXZMEZLD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3 |
| SMILES |
COc1cc(C2OCC3C(c4cc(OC)c(O)c(OC)c4)OCC23)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Fabaceae | Albizia falcataria | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Liliaceae | Lilium auratum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Ranunculaceae | Coptis japonica  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
|
|
zoom in
| Organism | Albizia falcataria | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|